C38H63N5O11 — CID 58232836
5-[[(Z)-7-[(1R,2S,3R)-2-[(E)-hept-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoyl]amino]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid (PubChem CID 58232836) has the molecular formula C38H63N5O11 and a molecular weight of 765.95 g/mol. Its IUPAC name is 5-[[(Z)-7-[(1R,2S,3R)-2-[(E)-hept-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoyl]amino]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid.
| Compound Name | 5-[[(Z)-7-[(1R,2S,3R)-2-[(E)-hept-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoyl]amino]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 58232836 |
| Molecular Formula | C38H63N5O11 |
| Molecular Weight | 765.95 g/mol |
| Exact Mass | 765.45 |
| IUPAC Name | 5-[[(Z)-7-[(1R,2S,3R)-2-[(E)-hept-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoyl]amino]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid |
| SMILES | CCCCC/C=C/[C@@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)NCCCC(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C38H63N5O11/c1-2-3-4-5-8-12-29-30(33(45)25-32(29)44)13-9-6-7-10-15-34(46)39-16-11-14-31(38(53)54)43-23-21-41(27-36(49)50)19-17-40(26-35(47)48)18-20-42(22-24-43)28-37(51)52/h6,8-9,12,29-32,44H,2-5,7,10-11,13-28H2,1H3,(H,39,46)(H,47,48)(H,49,50)(H,51,52)(H,53,54)/b9-6-,12-8+/t29-,30+,31?,32+/m0/s1 |
| InChIKey | WGLTTYDKCRYGQH-JJOCDOJCSA-N |
| XLogP | 1.63 |
| TPSA | 228.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.95 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|