About CID 58232935
CID 58232935 (PubChem CID 58232935) has the molecular formula C42H37InN8NaO6S
and a molecular weight of 919.68 g/mol.
Molecular Properties
| Compound Name | CID 58232935 |
| PubChem CID | 58232935 |
| Molecular Formula | C42H37InN8NaO6S |
| Molecular Weight | 919.68 g/mol |
| Exact Mass | 919.15 |
| IUPAC Name | — |
| SMILES | CCCCOc1ccc(C)c2c3n4c(c12)/N=C1\N=C(/N=c2/c5c(OCCCC)ccc(C)c5/c(n2[In]4)=N/C2=N/C(=N\3)c3ccccc32)c2ccc(S(=O)(=O)[O-])cc21.O.[Na+] |
| InChI | InChI=1S/C42H36N8O5S.In.Na.H2O/c1-5-7-19-54-29-17-13-22(3)31-33(29)41-47-37-27-16-15-24(56(51,52)53)21-28(27)38(44-37)48-42-34-30(55-20-8-6-2)18-14-23(4)32(34)40(50-42)46-36-26-12-10-9-11-25(26)35(43-36)45-39(31)49-41;;;/h9-18,21H,5-8,19-20H2,1-4H3,(H-2,43,44,45,46,47,48,49,50,51,52,53);;;1H2/q-2;+2;+1;/p-1 |
| InChIKey | DJHZEHYIRUTUJE-UHFFFAOYSA-M |
| XLogP | 2.53 |
| TPSA | 191.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 919.68 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 58232935 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58232935?
The IUPAC name of CID 58232935 (CID 58232935) is not available.
What is the SMILES notation for CID 58232935?
The canonical SMILES for CID 58232935 is CCCCOc1ccc(C)c2c3n4c(c12)/N=C1\N=C(/N=c2/c5c(OCCCC)ccc(C)c5/c(n2[In]4)=N/C2=N/C(=N\3)c3ccccc32)c2ccc(S(=O)(=O)[O-])cc21.O.[Na+].
What is the InChIKey of CID 58232935?
The InChIKey is DJHZEHYIRUTUJE-UHFFFAOYSA-M. The full InChI is InChI=1S/C42H36N8O5S.In.Na.H2O/c1-5-7-19-54-29-17-13-22(3)31-33(29)41-47-37-27-16-15-24(56(51,52)53)21-28(27)38(44-37)48-42-34-30(55-20-8-6-2)18-14-23(4)32(34)40(50-42)46-36-26-12-10-9-11-25(26)35(43-36)45-39(31)49-41;;;/h9-18,21H,5-8,19-20H2,1-4H3,(H-2,43,44,45,46,47,48,49,50,51,52,53);;;1H2/q-2;+2;+1;/p-1.
What are the key properties of CID 58232935?
CID 58232935 has a molecular weight of 919.68 g/mol, XLogP of 2.53, 9 rotatable bonds, 0 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58232935 is sourced from PubChem (CID 58232935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).