C58H47N3O4S2 — CID 58232970
(E)-3-[5-[7-[3,5-bis(N-naphthalen-2-ylanilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-4-hexylthiophen-2-yl]-2-cyanoprop-2-enoic acid (PubChem CID 58232970) has the molecular formula C58H47N3O4S2 and a molecular weight of 914.17 g/mol. Its IUPAC name is (E)-3-[5-[7-[3,5-bis(N-naphthalen-2-ylanilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-4-hexylthiophen-2-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[5-[7-[3,5-bis(N-naphthalen-2-ylanilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-4-hexylthiophen-2-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 58232970 |
| Molecular Formula | C58H47N3O4S2 |
| Molecular Weight | 914.17 g/mol |
| Exact Mass | 913.30 |
| IUPAC Name | (E)-3-[5-[7-[3,5-bis(N-naphthalen-2-ylanilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-4-hexylthiophen-2-yl]-2-cyanoprop-2-enoic acid |
| SMILES | CCCCCCc1cc(/C=C(\C#N)C(=O)O)sc1-c1sc(-c2cc(N(c3ccccc3)c3ccc4ccccc4c3)cc(N(c3ccccc3)c3ccc4ccccc4c3)c2)c2c1OCCO2 |
| InChI | InChI=1S/C58H47N3O4S2/c1-2-3-4-7-20-43-35-52(36-45(38-59)58(62)63)66-56(43)57-54-53(64-29-30-65-54)55(67-57)44-33-50(60(46-21-8-5-9-22-46)48-27-25-39-16-12-14-18-41(39)31-48)37-51(34-44)61(47-23-10-6-11-24-47)49-28-26-40-17-13-15-19-42(40)32-49/h5-6,8-19,21-28,31-37H,2-4,7,20,29-30H2,1H3,(H,62,63)/b45-36+ |
| InChIKey | ANOWJCOQFPIDCS-AESNPLDJSA-N |
| XLogP | 16.28 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.17 |
| LogP ≤ 5 | 16.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|