C48H46N2O4S3 — CID 58232976
(E)-3-[5-[5-[5-(4-carbazol-9-ylphenyl)-4-hexylthiophen-2-yl]-4-hexylthiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-isocyanoprop-2-enoic acid (PubChem CID 58232976) has the molecular formula C48H46N2O4S3 and a molecular weight of 811.11 g/mol. Its IUPAC name is (E)-3-[5-[5-[5-(4-carbazol-9-ylphenyl)-4-hexylthiophen-2-yl]-4-hexylthiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-isocyanoprop-2-enoic acid.
| Compound Name | (E)-3-[5-[5-[5-(4-carbazol-9-ylphenyl)-4-hexylthiophen-2-yl]-4-hexylthiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-isocyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 58232976 |
| Molecular Formula | C48H46N2O4S3 |
| Molecular Weight | 811.11 g/mol |
| Exact Mass | 810.26 |
| IUPAC Name | (E)-3-[5-[5-[5-(4-carbazol-9-ylphenyl)-4-hexylthiophen-2-yl]-4-hexylthiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-isocyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C/c1sc(-c2cc(CCCCCC)c(-c3cc(CCCCCC)c(-c4ccc(-n5c6ccccc6c6ccccc65)cc4)s3)s2)c2c1OCCO2)C(=O)O |
| InChI | InChI=1S/C48H46N2O4S3/c1-4-6-8-10-16-32-28-41(56-45(32)31-22-24-34(25-23-31)50-38-20-14-12-18-35(38)36-19-13-15-21-39(36)50)46-33(17-11-9-7-5-2)29-42(57-46)47-44-43(53-26-27-54-44)40(55-47)30-37(49-3)48(51)52/h12-15,18-25,28-30H,4-11,16-17,26-27H2,1-2H3,(H,51,52)/b37-30+ |
| InChIKey | MGVBMKYSSMLRBQ-GGFUHWEBSA-N |
| XLogP | 14.33 |
| TPSA | 65.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.11 |
| LogP ≤ 5 | 14.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|