C38H32N2O4S2 — CID 58232979
(Z)-3-[5-[5-(4-carbazol-9-ylphenyl)-4-hexylthiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-cyanoprop-2-enoic acid (PubChem CID 58232979) has the molecular formula C38H32N2O4S2 and a molecular weight of 644.82 g/mol. Its IUPAC name is (Z)-3-[5-[5-(4-carbazol-9-ylphenyl)-4-hexylthiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[5-[5-(4-carbazol-9-ylphenyl)-4-hexylthiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 58232979 |
| Molecular Formula | C38H32N2O4S2 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.18 |
| IUPAC Name | (Z)-3-[5-[5-(4-carbazol-9-ylphenyl)-4-hexylthiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-cyanoprop-2-enoic acid |
| SMILES | CCCCCCc1cc(-c2sc(/C=C(/C#N)C(=O)O)c3c2OCCO3)sc1-c1ccc(-n2c3ccccc3c3ccccc32)cc1 |
| InChI | InChI=1S/C38H32N2O4S2/c1-2-3-4-5-10-25-21-33(37-35-34(43-19-20-44-35)32(45-37)22-26(23-39)38(41)42)46-36(25)24-15-17-27(18-16-24)40-30-13-8-6-11-28(30)29-12-7-9-14-31(29)40/h6-9,11-18,21-22H,2-5,10,19-20H2,1H3,(H,41,42)/b26-22- |
| InChIKey | JMFDTIRNIGKWSQ-ROMGYVFFSA-N |
| XLogP | 10.13 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|