C56H50N2O4S2 — CID 58232986
(E)-3-[5-[7-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-4-hexylthiophen-2-yl]-2-cyanoprop-2-enoic acid (PubChem CID 58232986) has the molecular formula C56H50N2O4S2 and a molecular weight of 879.16 g/mol. Its IUPAC name is (E)-3-[5-[7-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-4-hexylthiophen-2-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[5-[7-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-4-hexylthiophen-2-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 58232986 |
| Molecular Formula | C56H50N2O4S2 |
| Molecular Weight | 879.16 g/mol |
| Exact Mass | 878.32 |
| IUPAC Name | (E)-3-[5-[7-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-4-hexylthiophen-2-yl]-2-cyanoprop-2-enoic acid |
| SMILES | CCCCCCc1cc(/C=C(\C#N)C(=O)O)sc1-c1sc(-c2ccc(N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc2)c2c1OCCO2 |
| InChI | InChI=1S/C56H50N2O4S2/c1-6-7-8-9-14-35-29-40(30-36(33-57)54(59)60)63-52(35)53-50-49(61-27-28-62-50)51(64-53)34-19-21-37(22-20-34)58(38-23-25-43-41-15-10-12-17-45(41)55(2,3)47(43)31-38)39-24-26-44-42-16-11-13-18-46(42)56(4,5)48(44)32-39/h10-13,15-26,29-32H,6-9,14,27-28H2,1-5H3,(H,59,60)/b36-30+ |
| InChIKey | HIPAGUZWFPFKRU-FMIFUCRQSA-N |
| XLogP | 15.11 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.16 |
| LogP ≤ 5 | 15.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|