C48H46N2O4S3 — CID 58232993
(E)-3-[5-[5-[7-(4-carbazol-9-ylphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-4-hexylthiophen-2-yl]-4-hexylthiophen-2-yl]-2-cyanoprop-2-enoic acid (PubChem CID 58232993) has the molecular formula C48H46N2O4S3 and a molecular weight of 811.11 g/mol. Its IUPAC name is (E)-3-[5-[5-[7-(4-carbazol-9-ylphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-4-hexylthiophen-2-yl]-4-hexylthiophen-2-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[5-[5-[7-(4-carbazol-9-ylphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-4-hexylthiophen-2-yl]-4-hexylthiophen-2-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 58232993 |
| Molecular Formula | C48H46N2O4S3 |
| Molecular Weight | 811.11 g/mol |
| Exact Mass | 810.26 |
| IUPAC Name | (E)-3-[5-[5-[7-(4-carbazol-9-ylphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-4-hexylthiophen-2-yl]-4-hexylthiophen-2-yl]-2-cyanoprop-2-enoic acid |
| SMILES | CCCCCCc1cc(/C=C(\C#N)C(=O)O)sc1-c1cc(CCCCCC)c(-c2sc(-c3ccc(-n4c5ccccc5c5ccccc54)cc3)c3c2OCCO3)s1 |
| InChI | InChI=1S/C48H46N2O4S3/c1-3-5-7-9-15-32-27-36(28-34(30-49)48(51)52)55-44(32)41-29-33(16-10-8-6-4-2)46(56-41)47-43-42(53-25-26-54-43)45(57-47)31-21-23-35(24-22-31)50-39-19-13-11-17-37(39)38-18-12-14-20-40(38)50/h11-14,17-24,27-29H,3-10,15-16,25-26H2,1-2H3,(H,51,52)/b34-28+ |
| InChIKey | TXGVYMBSRICWMY-CDSHQWRTSA-N |
| XLogP | 13.98 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.11 |
| LogP ≤ 5 | 13.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|