About 1H-indol-2-ylmethanamine
1H-indol-2-ylmethanamine (PubChem CID 582331) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 1H-indol-2-ylmethanamine.
Molecular Properties
| Compound Name | 1H-indol-2-ylmethanamine |
| PubChem CID | 582331 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 1H-indol-2-ylmethanamine |
| SMILES | NCc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C9H10N2/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-5,11H,6,10H2 |
| InChIKey | RNAODKZCUVVPEN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-indol-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-2-ylmethanamine?
The IUPAC name of 1H-indol-2-ylmethanamine (CID 582331) is 1H-indol-2-ylmethanamine.
What is the SMILES notation for 1H-indol-2-ylmethanamine?
The canonical SMILES for 1H-indol-2-ylmethanamine is NCc1cc2ccccc2[nH]1.
What is the InChIKey of 1H-indol-2-ylmethanamine?
The InChIKey is RNAODKZCUVVPEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-5,11H,6,10H2.
What are the key properties of 1H-indol-2-ylmethanamine?
1H-indol-2-ylmethanamine has a molecular weight of 146.19 g/mol, XLogP of 1.63, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-2-ylmethanamine is sourced from PubChem (CID 582331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).