C31H25N3 — CID 58233246
2,4-diphenyl-6-(7,9,9-trimethylfluoren-2-yl)-1,3,5-triazine (PubChem CID 58233246) has the molecular formula C31H25N3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2,4-diphenyl-6-(7,9,9-trimethylfluoren-2-yl)-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-(7,9,9-trimethylfluoren-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 58233246 |
| Molecular Formula | C31H25N3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 2,4-diphenyl-6-(7,9,9-trimethylfluoren-2-yl)-1,3,5-triazine |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc1-2 |
| InChI | InChI=1S/C31H25N3/c1-20-14-16-24-25-17-15-23(19-27(25)31(2,3)26(24)18-20)30-33-28(21-10-6-4-7-11-21)32-29(34-30)22-12-8-5-9-13-22/h4-19H,1-3H3 |
| InChIKey | PJOQIDBFCPDHTJ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |