C44H27N5 — CID 58233247
2-(2',7'-dimethyl-9,9'-spirobi[fluorene]-2-yl)-4,6-bis(4-isocyanophenyl)-1,3,5-triazine (PubChem CID 58233247) has the molecular formula C44H27N5 and a molecular weight of 625.74 g/mol. Its IUPAC name is 2-(2',7'-dimethyl-9,9'-spirobi[fluorene]-2-yl)-4,6-bis(4-isocyanophenyl)-1,3,5-triazine.
| Compound Name | 2-(2',7'-dimethyl-9,9'-spirobi[fluorene]-2-yl)-4,6-bis(4-isocyanophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 58233247 |
| Molecular Formula | C44H27N5 |
| Molecular Weight | 625.74 g/mol |
| Exact Mass | 625.23 |
| IUPAC Name | 2-(2',7'-dimethyl-9,9'-spirobi[fluorene]-2-yl)-4,6-bis(4-isocyanophenyl)-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc(-c2nc(-c3ccc([N+]#[C-])cc3)nc(-c3ccc4c(c3)C3(c5ccccc5-4)c4cc(C)ccc4-c4ccc(C)cc43)n2)cc1 |
| InChI | InChI=1S/C44H27N5/c1-26-9-20-34-35-21-10-27(2)24-39(35)44(38(34)23-26)37-8-6-5-7-33(37)36-22-15-30(25-40(36)44)43-48-41(28-11-16-31(45-3)17-12-28)47-42(49-43)29-13-18-32(46-4)19-14-29/h5-25H,1-2H3 |
| InChIKey | MEDFHQHEOWFPRQ-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 47.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.74 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|