C56H44N6 — CID 58233303
2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6,6,10,12,12-hexamethylindeno[1,2-b]fluoren-8-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 58233303) has the molecular formula C56H44N6 and a molecular weight of 801.01 g/mol. Its IUPAC name is 2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6,6,10,12,12-hexamethylindeno[1,2-b]fluoren-8-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6,6,10,12,12-hexamethylindeno[1,2-b]fluoren-8-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 58233303 |
| Molecular Formula | C56H44N6 |
| Molecular Weight | 801.01 g/mol |
| Exact Mass | 800.36 |
| IUPAC Name | 2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6,6,10,12,12-hexamethylindeno[1,2-b]fluoren-8-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Cc1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc2c1-c1cc3c(cc1C2(C)C)-c1c(C)cc(-c2nc(-c4ccccc4)nc(-c4ccccc4)n2)cc1C3(C)C |
| InChI | InChI=1S/C56H44N6/c1-33-27-39(53-59-49(35-19-11-7-12-20-35)57-50(60-53)36-21-13-8-14-22-36)29-45-47(33)41-31-44-42(32-43(41)55(45,3)4)48-34(2)28-40(30-46(48)56(44,5)6)54-61-51(37-23-15-9-16-24-37)58-52(62-54)38-25-17-10-18-26-38/h7-32H,1-6H3 |
| InChIKey | ZKIFUDLBZWIDBQ-UHFFFAOYSA-N |
| XLogP | 13.29 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.01 |
| LogP ≤ 5 | 13.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |