C62H44N10 — CID 58233314
2-[4-[2-[4-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]-6,6,12,12-tetramethylindeno[1,2-b]fluoren-8-yl]phenyl]-4,6-dipyridin-2-yl-1,3,5-triazine (PubChem CID 58233314) has the molecular formula C62H44N10 and a molecular weight of 929.10 g/mol. Its IUPAC name is 2-[4-[2-[4-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]-6,6,12,12-tetramethylindeno[1,2-b]fluoren-8-yl]phenyl]-4,6-dipyridin-2-yl-1,3,5-triazine.
| Compound Name | 2-[4-[2-[4-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]-6,6,12,12-tetramethylindeno[1,2-b]fluoren-8-yl]phenyl]-4,6-dipyridin-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 58233314 |
| Molecular Formula | C62H44N10 |
| Molecular Weight | 929.10 g/mol |
| Exact Mass | 928.38 |
| IUPAC Name | 2-[4-[2-[4-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]-6,6,12,12-tetramethylindeno[1,2-b]fluoren-8-yl]phenyl]-4,6-dipyridin-2-yl-1,3,5-triazine |
| SMILES | CC1(C)c2cc(-c3ccc(-c4nc(-c5ccccn5)nc(-c5ccccn5)n4)cc3)ccc2-c2cc3c(cc21)-c1ccc(-c2ccc(-c4nc(-c5ccccn5)nc(-c5ccccn5)n4)cc2)cc1C3(C)C |
| InChI | InChI=1S/C62H44N10/c1-61(2)47-33-41(37-17-21-39(22-18-37)55-67-57(51-13-5-9-29-63-51)71-58(68-55)52-14-6-10-30-64-52)25-27-43(47)45-36-50-46(35-49(45)61)44-28-26-42(34-48(44)62(50,3)4)38-19-23-40(24-20-38)56-69-59(53-15-7-11-31-65-53)72-60(70-56)54-16-8-12-32-66-54/h5-36H,1-4H3 |
| InChIKey | NRSZISOTLWAVPM-UHFFFAOYSA-N |
| XLogP | 13.59 |
| TPSA | 128.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.10 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |