C51H32N10 — CID 58233341
2-[7-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)-9,9-diphenylfluoren-2-yl]-4,6-dipyridin-2-yl-1,3,5-triazine (PubChem CID 58233341) has the molecular formula C51H32N10 and a molecular weight of 784.89 g/mol. Its IUPAC name is 2-[7-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)-9,9-diphenylfluoren-2-yl]-4,6-dipyridin-2-yl-1,3,5-triazine.
| Compound Name | 2-[7-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)-9,9-diphenylfluoren-2-yl]-4,6-dipyridin-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 58233341 |
| Molecular Formula | C51H32N10 |
| Molecular Weight | 784.89 g/mol |
| Exact Mass | 784.28 |
| IUPAC Name | 2-[7-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)-9,9-diphenylfluoren-2-yl]-4,6-dipyridin-2-yl-1,3,5-triazine |
| SMILES | c1ccc(C2(c3ccccc3)c3cc(-c4nc(-c5ccccn5)nc(-c5ccccn5)n4)ccc3-c3ccc(-c4nc(-c5ccccn5)nc(-c5ccccn5)n4)cc32)cc1 |
| InChI | InChI=1S/C51H32N10/c1-3-15-35(16-4-1)51(36-17-5-2-6-18-36)39-31-33(45-56-47(41-19-7-11-27-52-41)60-48(57-45)42-20-8-12-28-53-42)23-25-37(39)38-26-24-34(32-40(38)51)46-58-49(43-21-9-13-29-54-43)61-50(59-46)44-22-10-14-30-55-44/h1-32H |
| InChIKey | YUHIGAGSOXBYHJ-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 128.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.89 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |