C45H37N5 — CID 58233342
2,4-dipyridin-2-yl-6-[10-(1,1,4,4-tetramethyl-2,3-dihydrophenanthren-9-yl)anthracen-9-yl]-1,3,5-triazine (PubChem CID 58233342) has the molecular formula C45H37N5 and a molecular weight of 647.83 g/mol. Its IUPAC name is 2,4-dipyridin-2-yl-6-[10-(1,1,4,4-tetramethyl-2,3-dihydrophenanthren-9-yl)anthracen-9-yl]-1,3,5-triazine.
| Compound Name | 2,4-dipyridin-2-yl-6-[10-(1,1,4,4-tetramethyl-2,3-dihydrophenanthren-9-yl)anthracen-9-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 58233342 |
| Molecular Formula | C45H37N5 |
| Molecular Weight | 647.83 g/mol |
| Exact Mass | 647.30 |
| IUPAC Name | 2,4-dipyridin-2-yl-6-[10-(1,1,4,4-tetramethyl-2,3-dihydrophenanthren-9-yl)anthracen-9-yl]-1,3,5-triazine |
| SMILES | CC1(C)CCC(C)(C)c2c1cc(-c1c3ccccc3c(-c3nc(-c4ccccn4)nc(-c4ccccn4)n3)c3ccccc13)c1ccccc21 |
| InChI | InChI=1S/C45H37N5/c1-44(2)23-24-45(3,4)40-33-20-10-5-15-28(33)34(27-35(40)44)38-29-16-6-8-18-31(29)39(32-19-9-7-17-30(32)38)43-49-41(36-21-11-13-25-46-36)48-42(50-43)37-22-12-14-26-47-37/h5-22,25-27H,23-24H2,1-4H3 |
| InChIKey | IOKFGRHWULPPHL-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.83 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|