C48H29N7 — CID 58233362
2,4-bis(5-pyridin-2-yl-2-pyridinyl)-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine (PubChem CID 58233362) has the molecular formula C48H29N7 and a molecular weight of 703.81 g/mol. Its IUPAC name is 2,4-bis(5-pyridin-2-yl-2-pyridinyl)-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine.
| Compound Name | 2,4-bis(5-pyridin-2-yl-2-pyridinyl)-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 58233362 |
| Molecular Formula | C48H29N7 |
| Molecular Weight | 703.81 g/mol |
| Exact Mass | 703.25 |
| IUPAC Name | 2,4-bis(5-pyridin-2-yl-2-pyridinyl)-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc5c(c4)C4(c6ccccc6-c6ccccc64)c4ccccc4-5)nc(-c4ccc(-c5ccccn5)cn4)n3)nc2)nc1 |
| InChI | InChI=1S/C48H29N7/c1-4-14-37-33(11-1)34-12-2-5-15-38(34)48(37)39-16-6-3-13-35(39)36-22-19-30(27-40(36)48)45-53-46(43-23-20-31(28-51-43)41-17-7-9-25-49-41)55-47(54-45)44-24-21-32(29-52-44)42-18-8-10-26-50-42/h1-29H |
| InChIKey | BSPIPAJWMMKZPB-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.81 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |