C42H32N4 — CID 58233378
7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethyl-N,N-diphenylfluoren-2-amine (PubChem CID 58233378) has the molecular formula C42H32N4 and a molecular weight of 592.75 g/mol. Its IUPAC name is 7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethyl-N,N-diphenylfluoren-2-amine.
| Compound Name | 7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethyl-N,N-diphenylfluoren-2-amine |
|---|---|
| PubChem CID | 58233378 |
| Molecular Formula | C42H32N4 |
| Molecular Weight | 592.75 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | 7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethyl-N,N-diphenylfluoren-2-amine |
| SMILES | CC1(C)c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2-c2ccc(N(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C42H32N4/c1-42(2)37-27-31(41-44-39(29-15-7-3-8-16-29)43-40(45-41)30-17-9-4-10-18-30)23-25-35(37)36-26-24-34(28-38(36)42)46(32-19-11-5-12-20-32)33-21-13-6-14-22-33/h3-28H,1-2H3 |
| InChIKey | AVBLUXRKOOBWGB-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.75 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |