About 1-methyl-4,4-di(propan-2-yl)-2,3-dihydropyridine
1-methyl-4,4-di(propan-2-yl)-2,3-dihydropyridine (PubChem CID 58233773) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is 1-methyl-4,4-di(propan-2-yl)-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 1-methyl-4,4-di(propan-2-yl)-2,3-dihydropyridine |
| PubChem CID | 58233773 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 1-methyl-4,4-di(propan-2-yl)-2,3-dihydropyridine |
| SMILES | CC(C)C1(C(C)C)C=CN(C)CC1 |
| InChI | InChI=1S/C12H23N/c1-10(2)12(11(3)4)6-8-13(5)9-7-12/h6,8,10-11H,7,9H2,1-5H3 |
| InChIKey | SQHBWQUMCRWKKR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-4,4-di(propan-2-yl)-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4,4-di(propan-2-yl)-2,3-dihydropyridine?
The IUPAC name of 1-methyl-4,4-di(propan-2-yl)-2,3-dihydropyridine (CID 58233773) is 1-methyl-4,4-di(propan-2-yl)-2,3-dihydropyridine.
What is the SMILES notation for 1-methyl-4,4-di(propan-2-yl)-2,3-dihydropyridine?
The canonical SMILES for 1-methyl-4,4-di(propan-2-yl)-2,3-dihydropyridine is CC(C)C1(C(C)C)C=CN(C)CC1.
What is the InChIKey of 1-methyl-4,4-di(propan-2-yl)-2,3-dihydropyridine?
The InChIKey is SQHBWQUMCRWKKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N/c1-10(2)12(11(3)4)6-8-13(5)9-7-12/h6,8,10-11H,7,9H2,1-5H3.
What are the key properties of 1-methyl-4,4-di(propan-2-yl)-2,3-dihydropyridine?
1-methyl-4,4-di(propan-2-yl)-2,3-dihydropyridine has a molecular weight of 181.32 g/mol, XLogP of 3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4,4-di(propan-2-yl)-2,3-dihydropyridine is sourced from PubChem (CID 58233773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).