C15H16N4 — CID 58233785
spiro[4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-8,1'-cyclohexane]-5-amine (PubChem CID 58233785) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is spiro[4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-8,1'-cyclohexane]-5-amine.
| Compound Name | spiro[4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-8,1'-cyclohexane]-5-amine |
|---|---|
| PubChem CID | 58233785 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | spiro[4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-8,1'-cyclohexane]-5-amine |
| SMILES | Nc1ncc2c(n1)C1(CCCCC1)c1cnccc1-2 |
| InChI | InChI=1S/C15H16N4/c16-14-18-8-11-10-4-7-17-9-12(10)15(13(11)19-14)5-2-1-3-6-15/h4,7-9H,1-3,5-6H2,(H2,16,18,19) |
| InChIKey | BJFZWWUDPGHDTG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |