2-(sulfanylmethyl)pentanoic acid

C6H12O2S — CID 58234350

IUPAC2-(sulfanylmethyl)pentanoic acid
SMILESCCCC(CS)C(=O)O
InChIInChI=1S/C6H12O2S/c1-2-3-5(4-9)6(7)8/h5,9H,2-4H2,1H3,(H,7,8)
InChIKeyZYMIAABTPCKAPK-UHFFFAOYSA-N
MW148.23 g/mol
LogP1.42
Rot. Bonds4

About 2-(sulfanylmethyl)pentanoic acid

2-(sulfanylmethyl)pentanoic acid (PubChem CID 58234350) has the molecular formula C6H12O2S and a molecular weight of 148.23 g/mol. Its IUPAC name is 2-(sulfanylmethyl)pentanoic acid.

Molecular Properties

Compound Name2-(sulfanylmethyl)pentanoic acid
PubChem CID58234350
Molecular FormulaC6H12O2S
Molecular Weight148.23 g/mol
Exact Mass148.06
IUPAC Name2-(sulfanylmethyl)pentanoic acid
SMILESCCCC(CS)C(=O)O
InChIInChI=1S/C6H12O2S/c1-2-3-5(4-9)6(7)8/h5,9H,2-4H2,1H3,(H,7,8)
InChIKeyZYMIAABTPCKAPK-UHFFFAOYSA-N
XLogP1.42
TPSA37.30 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500148.23
LogP ≤ 51.42
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 2-(sulfanylmethyl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(sulfanylmethyl)pentanoic acid?
The IUPAC name of 2-(sulfanylmethyl)pentanoic acid (CID 58234350) is 2-(sulfanylmethyl)pentanoic acid.
What is the SMILES notation for 2-(sulfanylmethyl)pentanoic acid?
The canonical SMILES for 2-(sulfanylmethyl)pentanoic acid is CCCC(CS)C(=O)O.
What is the InChIKey of 2-(sulfanylmethyl)pentanoic acid?
The InChIKey is ZYMIAABTPCKAPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2S/c1-2-3-5(4-9)6(7)8/h5,9H,2-4H2,1H3,(H,7,8).
What are the key properties of 2-(sulfanylmethyl)pentanoic acid?
2-(sulfanylmethyl)pentanoic acid has a molecular weight of 148.23 g/mol, XLogP of 1.42, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(sulfanylmethyl)pentanoic acid is sourced from PubChem (CID 58234350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).