C28H33N5O2 — CID 58234505
4-amino-6-butoxy-1-[[6-[4-(pyrrolidin-1-ylmethyl)phenyl]-3-pyridinyl]methyl]-3H-pyrrolo[3,2-c]pyridin-2-one (PubChem CID 58234505) has the molecular formula C28H33N5O2 and a molecular weight of 471.61 g/mol. Its IUPAC name is 4-amino-6-butoxy-1-[[6-[4-(pyrrolidin-1-ylmethyl)phenyl]-3-pyridinyl]methyl]-3H-pyrrolo[3,2-c]pyridin-2-one.
| Compound Name | 4-amino-6-butoxy-1-[[6-[4-(pyrrolidin-1-ylmethyl)phenyl]-3-pyridinyl]methyl]-3H-pyrrolo[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 58234505 |
| Molecular Formula | C28H33N5O2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 4-amino-6-butoxy-1-[[6-[4-(pyrrolidin-1-ylmethyl)phenyl]-3-pyridinyl]methyl]-3H-pyrrolo[3,2-c]pyridin-2-one |
| SMILES | CCCCOc1cc2c(c(N)n1)CC(=O)N2Cc1ccc(-c2ccc(CN3CCCC3)cc2)nc1 |
| InChI | InChI=1S/C28H33N5O2/c1-2-3-14-35-26-16-25-23(28(29)31-26)15-27(34)33(25)19-21-8-11-24(30-17-21)22-9-6-20(7-10-22)18-32-12-4-5-13-32/h6-11,16-17H,2-5,12-15,18-19H2,1H3,(H2,29,31) |
| InChIKey | FEOWTCPFOYAUHN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|