C28H32FN5O2 — CID 58234611
4-amino-2-butoxy-7-[[4-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]phenyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 58234611) has the molecular formula C28H32FN5O2 and a molecular weight of 489.60 g/mol. Its IUPAC name is 4-amino-2-butoxy-7-[[4-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]phenyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-2-butoxy-7-[[4-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]phenyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 58234611 |
| Molecular Formula | C28H32FN5O2 |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 4-amino-2-butoxy-7-[[4-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]phenyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CCCCOc1nc(N)c2c(n1)N(Cc1ccc(-c3ccc(CN4CCCC4)c(F)c3)cc1)C(=O)C2 |
| InChI | InChI=1S/C28H32FN5O2/c1-2-3-14-36-28-31-26(30)23-16-25(35)34(27(23)32-28)17-19-6-8-20(9-7-19)21-10-11-22(24(29)15-21)18-33-12-4-5-13-33/h6-11,15H,2-5,12-14,16-18H2,1H3,(H2,30,31,32) |
| InChIKey | LKXUGRQYHLYIPT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|