About 3-[4-(3,5-ditert-butylphenyl)-6-(2-methyl-5-nitrophenyl)-2-pyridinyl]isoquinoline
3-[4-(3,5-ditert-butylphenyl)-6-(2-methyl-5-nitrophenyl)-2-pyridinyl]isoquinoline (PubChem CID 58234792) has the molecular formula C35H35N3O2
and a molecular weight of 529.68 g/mol. Its IUPAC name is 3-[4-(3,5-ditert-butylphenyl)-6-(2-methyl-5-nitrophenyl)-2-pyridinyl]isoquinoline.
Molecular Properties
| Compound Name | 3-[4-(3,5-ditert-butylphenyl)-6-(2-methyl-5-nitrophenyl)-2-pyridinyl]isoquinoline |
| PubChem CID | 58234792 |
| Molecular Formula | C35H35N3O2 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | 3-[4-(3,5-ditert-butylphenyl)-6-(2-methyl-5-nitrophenyl)-2-pyridinyl]isoquinoline |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-c1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(-c2cc3ccccc3cn2)n1 |
| InChI | InChI=1S/C35H35N3O2/c1-22-12-13-29(38(39)40)20-30(22)31-17-26(25-14-27(34(2,3)4)19-28(15-25)35(5,6)7)18-33(37-31)32-16-23-10-8-9-11-24(23)21-36-32/h8-21H,1-7H3 |
| InChIKey | CQMFKVWMYPUOSQ-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(3,5-ditert-butylphenyl)-6-(2-methyl-5-nitrophenyl)-2-pyridinyl]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3,5-ditert-butylphenyl)-6-(2-methyl-5-nitrophenyl)-2-pyridinyl]isoquinoline?
The IUPAC name of 3-[4-(3,5-ditert-butylphenyl)-6-(2-methyl-5-nitrophenyl)-2-pyridinyl]isoquinoline (CID 58234792) is 3-[4-(3,5-ditert-butylphenyl)-6-(2-methyl-5-nitrophenyl)-2-pyridinyl]isoquinoline.
What is the SMILES notation for 3-[4-(3,5-ditert-butylphenyl)-6-(2-methyl-5-nitrophenyl)-2-pyridinyl]isoquinoline?
The canonical SMILES for 3-[4-(3,5-ditert-butylphenyl)-6-(2-methyl-5-nitrophenyl)-2-pyridinyl]isoquinoline is Cc1ccc([N+](=O)[O-])cc1-c1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(-c2cc3ccccc3cn2)n1.
What is the InChIKey of 3-[4-(3,5-ditert-butylphenyl)-6-(2-methyl-5-nitrophenyl)-2-pyridinyl]isoquinoline?
The InChIKey is CQMFKVWMYPUOSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H35N3O2/c1-22-12-13-29(38(39)40)20-30(22)31-17-26(25-14-27(34(2,3)4)19-28(15-25)35(5,6)7)18-33(37-31)32-16-23-10-8-9-11-24(23)21-36-32/h8-21H,1-7H3.
What are the key properties of 3-[4-(3,5-ditert-butylphenyl)-6-(2-methyl-5-nitrophenyl)-2-pyridinyl]isoquinoline?
3-[4-(3,5-ditert-butylphenyl)-6-(2-methyl-5-nitrophenyl)-2-pyridinyl]isoquinoline has a molecular weight of 529.68 g/mol, XLogP of 9.44, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3,5-ditert-butylphenyl)-6-(2-methyl-5-nitrophenyl)-2-pyridinyl]isoquinoline is sourced from PubChem (CID 58234792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).