About 8-[1-(3,5-difluoroanilino)ethyl]-N-ethyl-2-morpholin-4-yl-4-oxochromene-6-carboxamide
8-[1-(3,5-difluoroanilino)ethyl]-N-ethyl-2-morpholin-4-yl-4-oxochromene-6-carboxamide (PubChem CID 58235033) has the molecular formula C24H25F2N3O4
and a molecular weight of 457.48 g/mol. Its IUPAC name is 8-[1-(3,5-difluoroanilino)ethyl]-N-ethyl-2-morpholin-4-yl-4-oxochromene-6-carboxamide.
Molecular Properties
| Compound Name | 8-[1-(3,5-difluoroanilino)ethyl]-N-ethyl-2-morpholin-4-yl-4-oxochromene-6-carboxamide |
| PubChem CID | 58235033 |
| Molecular Formula | C24H25F2N3O4 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 8-[1-(3,5-difluoroanilino)ethyl]-N-ethyl-2-morpholin-4-yl-4-oxochromene-6-carboxamide |
| SMILES | CCNC(=O)c1cc(C(C)Nc2cc(F)cc(F)c2)c2oc(N3CCOCC3)cc(=O)c2c1 |
| InChI | InChI=1S/C24H25F2N3O4/c1-3-27-24(31)15-8-19(14(2)28-18-11-16(25)10-17(26)12-18)23-20(9-15)21(30)13-22(33-23)29-4-6-32-7-5-29/h8-14,28H,3-7H2,1-2H3,(H,27,31) |
| InChIKey | BHDAOCAOTBBVOL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-[1-(3,5-difluoroanilino)ethyl]-N-ethyl-2-morpholin-4-yl-4-oxochromene-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[1-(3,5-difluoroanilino)ethyl]-N-ethyl-2-morpholin-4-yl-4-oxochromene-6-carboxamide?
The IUPAC name of 8-[1-(3,5-difluoroanilino)ethyl]-N-ethyl-2-morpholin-4-yl-4-oxochromene-6-carboxamide (CID 58235033) is 8-[1-(3,5-difluoroanilino)ethyl]-N-ethyl-2-morpholin-4-yl-4-oxochromene-6-carboxamide.
What is the SMILES notation for 8-[1-(3,5-difluoroanilino)ethyl]-N-ethyl-2-morpholin-4-yl-4-oxochromene-6-carboxamide?
The canonical SMILES for 8-[1-(3,5-difluoroanilino)ethyl]-N-ethyl-2-morpholin-4-yl-4-oxochromene-6-carboxamide is CCNC(=O)c1cc(C(C)Nc2cc(F)cc(F)c2)c2oc(N3CCOCC3)cc(=O)c2c1.
What is the InChIKey of 8-[1-(3,5-difluoroanilino)ethyl]-N-ethyl-2-morpholin-4-yl-4-oxochromene-6-carboxamide?
The InChIKey is BHDAOCAOTBBVOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25F2N3O4/c1-3-27-24(31)15-8-19(14(2)28-18-11-16(25)10-17(26)12-18)23-20(9-15)21(30)13-22(33-23)29-4-6-32-7-5-29/h8-14,28H,3-7H2,1-2H3,(H,27,31).
What are the key properties of 8-[1-(3,5-difluoroanilino)ethyl]-N-ethyl-2-morpholin-4-yl-4-oxochromene-6-carboxamide?
8-[1-(3,5-difluoroanilino)ethyl]-N-ethyl-2-morpholin-4-yl-4-oxochromene-6-carboxamide has a molecular weight of 457.48 g/mol, XLogP of 3.83, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[1-(3,5-difluoroanilino)ethyl]-N-ethyl-2-morpholin-4-yl-4-oxochromene-6-carboxamide is sourced from PubChem (CID 58235033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).