C24H21ClN4O — CID 58235229
[4-[3-[2-(6-amino-3-pyridinyl)ethynyl]-2-methyl-4-pyridinyl]-2-chlorophenyl]-pyrrolidin-1-ylmethanone (PubChem CID 58235229) has the molecular formula C24H21ClN4O and a molecular weight of 416.91 g/mol. Its IUPAC name is [4-[3-[2-(6-amino-3-pyridinyl)ethynyl]-2-methyl-4-pyridinyl]-2-chlorophenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-[3-[2-(6-amino-3-pyridinyl)ethynyl]-2-methyl-4-pyridinyl]-2-chlorophenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 58235229 |
| Molecular Formula | C24H21ClN4O |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [4-[3-[2-(6-amino-3-pyridinyl)ethynyl]-2-methyl-4-pyridinyl]-2-chlorophenyl]-pyrrolidin-1-ylmethanone |
| SMILES | Cc1nccc(-c2ccc(C(=O)N3CCCC3)c(Cl)c2)c1C#Cc1ccc(N)nc1 |
| InChI | InChI=1S/C24H21ClN4O/c1-16-19(7-4-17-5-9-23(26)28-15-17)20(10-11-27-16)18-6-8-21(22(25)14-18)24(30)29-12-2-3-13-29/h5-6,8-11,14-15H,2-3,12-13H2,1H3,(H2,26,28) |
| InChIKey | SBNOKNQLVTVDBO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|