About 5-[2-[4-(2,6-dimethyl-4-pyridinyl)-2-ethyl-3-pyridinyl]ethynyl]-6-methylpyridin-2-amine
5-[2-[4-(2,6-dimethyl-4-pyridinyl)-2-ethyl-3-pyridinyl]ethynyl]-6-methylpyridin-2-amine (PubChem CID 58235322) has the molecular formula C22H22N4
and a molecular weight of 342.45 g/mol. Its IUPAC name is 5-[2-[4-(2,6-dimethyl-4-pyridinyl)-2-ethyl-3-pyridinyl]ethynyl]-6-methylpyridin-2-amine.
Molecular Properties
| Compound Name | 5-[2-[4-(2,6-dimethyl-4-pyridinyl)-2-ethyl-3-pyridinyl]ethynyl]-6-methylpyridin-2-amine |
| PubChem CID | 58235322 |
| Molecular Formula | C22H22N4 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 5-[2-[4-(2,6-dimethyl-4-pyridinyl)-2-ethyl-3-pyridinyl]ethynyl]-6-methylpyridin-2-amine |
| SMILES | CCc1nccc(-c2cc(C)nc(C)c2)c1C#Cc1ccc(N)nc1C |
| InChI | InChI=1S/C22H22N4/c1-5-21-20(8-6-17-7-9-22(23)26-16(17)4)19(10-11-24-21)18-12-14(2)25-15(3)13-18/h7,9-13H,5H2,1-4H3,(H2,23,26) |
| InChIKey | ABNIDWHBBSGUDX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-[4-(2,6-dimethyl-4-pyridinyl)-2-ethyl-3-pyridinyl]ethynyl]-6-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[4-(2,6-dimethyl-4-pyridinyl)-2-ethyl-3-pyridinyl]ethynyl]-6-methylpyridin-2-amine?
The IUPAC name of 5-[2-[4-(2,6-dimethyl-4-pyridinyl)-2-ethyl-3-pyridinyl]ethynyl]-6-methylpyridin-2-amine (CID 58235322) is 5-[2-[4-(2,6-dimethyl-4-pyridinyl)-2-ethyl-3-pyridinyl]ethynyl]-6-methylpyridin-2-amine.
What is the SMILES notation for 5-[2-[4-(2,6-dimethyl-4-pyridinyl)-2-ethyl-3-pyridinyl]ethynyl]-6-methylpyridin-2-amine?
The canonical SMILES for 5-[2-[4-(2,6-dimethyl-4-pyridinyl)-2-ethyl-3-pyridinyl]ethynyl]-6-methylpyridin-2-amine is CCc1nccc(-c2cc(C)nc(C)c2)c1C#Cc1ccc(N)nc1C.
What is the InChIKey of 5-[2-[4-(2,6-dimethyl-4-pyridinyl)-2-ethyl-3-pyridinyl]ethynyl]-6-methylpyridin-2-amine?
The InChIKey is ABNIDWHBBSGUDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4/c1-5-21-20(8-6-17-7-9-22(23)26-16(17)4)19(10-11-24-21)18-12-14(2)25-15(3)13-18/h7,9-13H,5H2,1-4H3,(H2,23,26).
What are the key properties of 5-[2-[4-(2,6-dimethyl-4-pyridinyl)-2-ethyl-3-pyridinyl]ethynyl]-6-methylpyridin-2-amine?
5-[2-[4-(2,6-dimethyl-4-pyridinyl)-2-ethyl-3-pyridinyl]ethynyl]-6-methylpyridin-2-amine has a molecular weight of 342.45 g/mol, XLogP of 4.01, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[4-(2,6-dimethyl-4-pyridinyl)-2-ethyl-3-pyridinyl]ethynyl]-6-methylpyridin-2-amine is sourced from PubChem (CID 58235322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).