C24H32N2O5 — CID 58235513
[(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] (2S)-2-acetamido-3-methylbutanoate (PubChem CID 58235513) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is [(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] (2S)-2-acetamido-3-methylbutanoate.
| Compound Name | [(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] (2S)-2-acetamido-3-methylbutanoate |
|---|---|
| PubChem CID | 58235513 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | [(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] (2S)-2-acetamido-3-methylbutanoate |
| SMILES | COc1ccc2c3c1O[C@H]1C[C@@H](OC(=O)[C@@H](NC(C)=O)C(C)C)C=C[C@@]31CCN(C)C2 |
| InChI | InChI=1S/C24H32N2O5/c1-14(2)21(25-15(3)27)23(28)30-17-8-9-24-10-11-26(4)13-16-6-7-18(29-5)22(20(16)24)31-19(24)12-17/h6-9,14,17,19,21H,10-13H2,1-5H3,(H,25,27)/t17-,19-,21-,24-/m0/s1 |
| InChIKey | SJTIGJDSTLBYQW-FSJWIPBVSA-N |
| XLogP | 2.56 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|