C30H39ClN6O2S — CID 58235898
5-chloro-2-N-[2-methyl-4-(4-piperidin-1-ylpiperidin-1-yl)phenyl]-4-N-(2-propylsulfonylphenyl)pyrimidine-2,4-diamine (PubChem CID 58235898) has the molecular formula C30H39ClN6O2S and a molecular weight of 583.20 g/mol. Its IUPAC name is 5-chloro-2-N-[2-methyl-4-(4-piperidin-1-ylpiperidin-1-yl)phenyl]-4-N-(2-propylsulfonylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-[2-methyl-4-(4-piperidin-1-ylpiperidin-1-yl)phenyl]-4-N-(2-propylsulfonylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 58235898 |
| Molecular Formula | C30H39ClN6O2S |
| Molecular Weight | 583.20 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | 5-chloro-2-N-[2-methyl-4-(4-piperidin-1-ylpiperidin-1-yl)phenyl]-4-N-(2-propylsulfonylphenyl)pyrimidine-2,4-diamine |
| SMILES | CCCS(=O)(=O)c1ccccc1Nc1nc(Nc2ccc(N3CCC(N4CCCCC4)CC3)cc2C)ncc1Cl |
| InChI | InChI=1S/C30H39ClN6O2S/c1-3-19-40(38,39)28-10-6-5-9-27(28)33-29-25(31)21-32-30(35-29)34-26-12-11-24(20-22(26)2)37-17-13-23(14-18-37)36-15-7-4-8-16-36/h5-6,9-12,20-21,23H,3-4,7-8,13-19H2,1-2H3,(H2,32,33,34,35) |
| InChIKey | FAKVVNZBPAFOCM-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.20 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|