C16H14F3N3OS — CID 58236160
N-but-2-ynyl-4-methyl-2-pyridin-3-yl-N-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxamide (PubChem CID 58236160) has the molecular formula C16H14F3N3OS and a molecular weight of 353.37 g/mol. Its IUPAC name is N-but-2-ynyl-4-methyl-2-pyridin-3-yl-N-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-but-2-ynyl-4-methyl-2-pyridin-3-yl-N-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 58236160 |
| Molecular Formula | C16H14F3N3OS |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | N-but-2-ynyl-4-methyl-2-pyridin-3-yl-N-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxamide |
| SMILES | CC#CCN(CC(F)(F)F)C(=O)c1sc(-c2cccnc2)nc1C |
| InChI | InChI=1S/C16H14F3N3OS/c1-3-4-8-22(10-16(17,18)19)15(23)13-11(2)21-14(24-13)12-6-5-7-20-9-12/h5-7,9H,8,10H2,1-2H3 |
| InChIKey | IRQUKCULYDTKOI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|