C14H13F4N3OS — CID 58236273
N,4-dimethyl-2-pyridin-3-yl-N-(2,2,3,3-tetrafluoropropyl)-1,3-thiazole-5-carboxamide (PubChem CID 58236273) has the molecular formula C14H13F4N3OS and a molecular weight of 347.34 g/mol. Its IUPAC name is N,4-dimethyl-2-pyridin-3-yl-N-(2,2,3,3-tetrafluoropropyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N,4-dimethyl-2-pyridin-3-yl-N-(2,2,3,3-tetrafluoropropyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 58236273 |
| Molecular Formula | C14H13F4N3OS |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N,4-dimethyl-2-pyridin-3-yl-N-(2,2,3,3-tetrafluoropropyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2cccnc2)sc1C(=O)N(C)CC(F)(F)C(F)F |
| InChI | InChI=1S/C14H13F4N3OS/c1-8-10(12(22)21(2)7-14(17,18)13(15)16)23-11(20-8)9-4-3-5-19-6-9/h3-6,13H,7H2,1-2H3 |
| InChIKey | CTRXGSNMKVJPFW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|