About N,N,4-trimethyl-2-pyrimidin-5-yl-1,3-thiazole-5-carboxamide
N,N,4-trimethyl-2-pyrimidin-5-yl-1,3-thiazole-5-carboxamide (PubChem CID 58236280) has the molecular formula C11H12N4OS
and a molecular weight of 248.31 g/mol. Its IUPAC name is N,N,4-trimethyl-2-pyrimidin-5-yl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N,N,4-trimethyl-2-pyrimidin-5-yl-1,3-thiazole-5-carboxamide |
| PubChem CID | 58236280 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | N,N,4-trimethyl-2-pyrimidin-5-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2cncnc2)sc1C(=O)N(C)C |
| InChI | InChI=1S/C11H12N4OS/c1-7-9(11(16)15(2)3)17-10(14-7)8-4-12-6-13-5-8/h4-6H,1-3H3 |
| InChIKey | SMFBSPDUBUEZGN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N,4-trimethyl-2-pyrimidin-5-yl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,4-trimethyl-2-pyrimidin-5-yl-1,3-thiazole-5-carboxamide?
The IUPAC name of N,N,4-trimethyl-2-pyrimidin-5-yl-1,3-thiazole-5-carboxamide (CID 58236280) is N,N,4-trimethyl-2-pyrimidin-5-yl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N,N,4-trimethyl-2-pyrimidin-5-yl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N,N,4-trimethyl-2-pyrimidin-5-yl-1,3-thiazole-5-carboxamide is Cc1nc(-c2cncnc2)sc1C(=O)N(C)C.
What is the InChIKey of N,N,4-trimethyl-2-pyrimidin-5-yl-1,3-thiazole-5-carboxamide?
The InChIKey is SMFBSPDUBUEZGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4OS/c1-7-9(11(16)15(2)3)17-10(14-7)8-4-12-6-13-5-8/h4-6H,1-3H3.
What are the key properties of N,N,4-trimethyl-2-pyrimidin-5-yl-1,3-thiazole-5-carboxamide?
N,N,4-trimethyl-2-pyrimidin-5-yl-1,3-thiazole-5-carboxamide has a molecular weight of 248.31 g/mol, XLogP of 1.61, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,4-trimethyl-2-pyrimidin-5-yl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 58236280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).