C29H23F3N6O3S — CID 58236660
N-[3-[2-amino-5-[2-[3-fluoro-4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]-1,3-thiazol-4-yl]phenyl]-2,5-difluorobenzamide (PubChem CID 58236660) has the molecular formula C29H23F3N6O3S and a molecular weight of 592.60 g/mol. Its IUPAC name is N-[3-[2-amino-5-[2-[3-fluoro-4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]-1,3-thiazol-4-yl]phenyl]-2,5-difluorobenzamide.
| Compound Name | N-[3-[2-amino-5-[2-[3-fluoro-4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]-1,3-thiazol-4-yl]phenyl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 58236660 |
| Molecular Formula | C29H23F3N6O3S |
| Molecular Weight | 592.60 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | N-[3-[2-amino-5-[2-[3-fluoro-4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]-1,3-thiazol-4-yl]phenyl]-2,5-difluorobenzamide |
| SMILES | COCCOc1ccc(Nc2nccc(-c3sc(N)nc3-c3cccc(NC(=O)c4cc(F)ccc4F)c3)n2)cc1F |
| InChI | InChI=1S/C29H23F3N6O3S/c1-40-11-12-41-24-8-6-19(15-22(24)32)36-29-34-10-9-23(37-29)26-25(38-28(33)42-26)16-3-2-4-18(13-16)35-27(39)20-14-17(30)5-7-21(20)31/h2-10,13-15H,11-12H2,1H3,(H2,33,38)(H,35,39)(H,34,36,37) |
| InChIKey | YYSCXQDJRHQBRJ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.60 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|