C32H28F5N7O4S2 — CID 58236694
N-[3-[5-[2-[4-[2-(dimethylamino)ethoxy]anilino]pyrimidin-4-yl]-2-(2,2,2-trifluoroethylsulfonylamino)-1,3-thiazol-4-yl]phenyl]-2,6-difluorobenzamide (PubChem CID 58236694) has the molecular formula C32H28F5N7O4S2 and a molecular weight of 733.75 g/mol. Its IUPAC name is N-[3-[5-[2-[4-[2-(dimethylamino)ethoxy]anilino]pyrimidin-4-yl]-2-(2,2,2-trifluoroethylsulfonylamino)-1,3-thiazol-4-yl]phenyl]-2,6-difluorobenzamide.
| Compound Name | N-[3-[5-[2-[4-[2-(dimethylamino)ethoxy]anilino]pyrimidin-4-yl]-2-(2,2,2-trifluoroethylsulfonylamino)-1,3-thiazol-4-yl]phenyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 58236694 |
| Molecular Formula | C32H28F5N7O4S2 |
| Molecular Weight | 733.75 g/mol |
| Exact Mass | 733.16 |
| IUPAC Name | N-[3-[5-[2-[4-[2-(dimethylamino)ethoxy]anilino]pyrimidin-4-yl]-2-(2,2,2-trifluoroethylsulfonylamino)-1,3-thiazol-4-yl]phenyl]-2,6-difluorobenzamide |
| SMILES | CN(C)CCOc1ccc(Nc2nccc(-c3sc(NS(=O)(=O)CC(F)(F)F)nc3-c3cccc(NC(=O)c4c(F)cccc4F)c3)n2)cc1 |
| InChI | InChI=1S/C32H28F5N7O4S2/c1-44(2)15-16-48-22-11-9-20(10-12-22)40-30-38-14-13-25(41-30)28-27(42-31(49-28)43-50(46,47)18-32(35,36)37)19-5-3-6-21(17-19)39-29(45)26-23(33)7-4-8-24(26)34/h3-14,17H,15-16,18H2,1-2H3,(H,39,45)(H,42,43)(H,38,40,41) |
| InChIKey | FBRUUAFCJQXIDM-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.75 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |