About 5-(2-chloropyrimidin-4-yl)-4-(3-phenylmethoxyphenyl)-1,3-thiazol-2-amine
5-(2-chloropyrimidin-4-yl)-4-(3-phenylmethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 58236707) has the molecular formula C20H15ClN4OS
and a molecular weight of 394.89 g/mol. Its IUPAC name is 5-(2-chloropyrimidin-4-yl)-4-(3-phenylmethoxyphenyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-(2-chloropyrimidin-4-yl)-4-(3-phenylmethoxyphenyl)-1,3-thiazol-2-amine |
| PubChem CID | 58236707 |
| Molecular Formula | C20H15ClN4OS |
| Molecular Weight | 394.89 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 5-(2-chloropyrimidin-4-yl)-4-(3-phenylmethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2cccc(OCc3ccccc3)c2)c(-c2ccnc(Cl)n2)s1 |
| InChI | InChI=1S/C20H15ClN4OS/c21-19-23-10-9-16(24-19)18-17(25-20(22)27-18)14-7-4-8-15(11-14)26-12-13-5-2-1-3-6-13/h1-11H,12H2,(H2,22,25) |
| InChIKey | CEUNPMGPLRWVTM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.89 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(2-chloropyrimidin-4-yl)-4-(3-phenylmethoxyphenyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-chloropyrimidin-4-yl)-4-(3-phenylmethoxyphenyl)-1,3-thiazol-2-amine?
The IUPAC name of 5-(2-chloropyrimidin-4-yl)-4-(3-phenylmethoxyphenyl)-1,3-thiazol-2-amine (CID 58236707) is 5-(2-chloropyrimidin-4-yl)-4-(3-phenylmethoxyphenyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 5-(2-chloropyrimidin-4-yl)-4-(3-phenylmethoxyphenyl)-1,3-thiazol-2-amine?
The canonical SMILES for 5-(2-chloropyrimidin-4-yl)-4-(3-phenylmethoxyphenyl)-1,3-thiazol-2-amine is Nc1nc(-c2cccc(OCc3ccccc3)c2)c(-c2ccnc(Cl)n2)s1.
What is the InChIKey of 5-(2-chloropyrimidin-4-yl)-4-(3-phenylmethoxyphenyl)-1,3-thiazol-2-amine?
The InChIKey is CEUNPMGPLRWVTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15ClN4OS/c21-19-23-10-9-16(24-19)18-17(25-20(22)27-18)14-7-4-8-15(11-14)26-12-13-5-2-1-3-6-13/h1-11H,12H2,(H2,22,25).
What are the key properties of 5-(2-chloropyrimidin-4-yl)-4-(3-phenylmethoxyphenyl)-1,3-thiazol-2-amine?
5-(2-chloropyrimidin-4-yl)-4-(3-phenylmethoxyphenyl)-1,3-thiazol-2-amine has a molecular weight of 394.89 g/mol, XLogP of 5.08, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chloropyrimidin-4-yl)-4-(3-phenylmethoxyphenyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 58236707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).