C15H12FN3O5S — CID 58236955
6-fluoro-7-hydroxy-5-[(6-methylsulfonyl-3-pyridinyl)oxy]-1H-indole-2-carboxamide (PubChem CID 58236955) has the molecular formula C15H12FN3O5S and a molecular weight of 365.34 g/mol. Its IUPAC name is 6-fluoro-7-hydroxy-5-[(6-methylsulfonyl-3-pyridinyl)oxy]-1H-indole-2-carboxamide.
| Compound Name | 6-fluoro-7-hydroxy-5-[(6-methylsulfonyl-3-pyridinyl)oxy]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 58236955 |
| Molecular Formula | C15H12FN3O5S |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 6-fluoro-7-hydroxy-5-[(6-methylsulfonyl-3-pyridinyl)oxy]-1H-indole-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(Oc2cc3cc(C(N)=O)[nH]c3c(O)c2F)cn1 |
| InChI | InChI=1S/C15H12FN3O5S/c1-25(22,23)11-3-2-8(6-18-11)24-10-5-7-4-9(15(17)21)19-13(7)14(20)12(10)16/h2-6,19-20H,1H3,(H2,17,21) |
| InChIKey | KOGLJIGICZGADT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |