C25H30N2O6S2 — CID 58236978
2-[7-butan-2-yloxy-5-(4-methylsulfonylphenoxy)-1H-indol-2-yl]-5-(dimethoxymethyl)-4,5-dihydro-1,3-thiazole (PubChem CID 58236978) has the molecular formula C25H30N2O6S2 and a molecular weight of 518.66 g/mol. Its IUPAC name is 2-[7-butan-2-yloxy-5-(4-methylsulfonylphenoxy)-1H-indol-2-yl]-5-(dimethoxymethyl)-4,5-dihydro-1,3-thiazole.
| Compound Name | 2-[7-butan-2-yloxy-5-(4-methylsulfonylphenoxy)-1H-indol-2-yl]-5-(dimethoxymethyl)-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 58236978 |
| Molecular Formula | C25H30N2O6S2 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 2-[7-butan-2-yloxy-5-(4-methylsulfonylphenoxy)-1H-indol-2-yl]-5-(dimethoxymethyl)-4,5-dihydro-1,3-thiazole |
| SMILES | CCC(C)Oc1cc(Oc2ccc(S(C)(=O)=O)cc2)cc2cc(C3=NCC(C(OC)OC)S3)[nH]c12 |
| InChI | InChI=1S/C25H30N2O6S2/c1-6-15(2)32-21-13-18(33-17-7-9-19(10-8-17)35(5,28)29)11-16-12-20(27-23(16)21)24-26-14-22(34-24)25(30-3)31-4/h7-13,15,22,25,27H,6,14H2,1-5H3 |
| InChIKey | JSSUCVHXSIDRTA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 99.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|