About N-isoquinolin-1-yl-4,6-dimethyl-2H-benzotriazole-5-sulfonamide
N-isoquinolin-1-yl-4,6-dimethyl-2H-benzotriazole-5-sulfonamide (PubChem CID 58237693) has the molecular formula C17H15N5O2S
and a molecular weight of 353.41 g/mol. Its IUPAC name is N-isoquinolin-1-yl-4,6-dimethyl-2H-benzotriazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-isoquinolin-1-yl-4,6-dimethyl-2H-benzotriazole-5-sulfonamide |
| PubChem CID | 58237693 |
| Molecular Formula | C17H15N5O2S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | N-isoquinolin-1-yl-4,6-dimethyl-2H-benzotriazole-5-sulfonamide |
| SMILES | Cc1cc2n[nH]nc2c(C)c1S(=O)(=O)Nc1nccc2ccccc12 |
| InChI | InChI=1S/C17H15N5O2S/c1-10-9-14-15(20-22-19-14)11(2)16(10)25(23,24)21-17-13-6-4-3-5-12(13)7-8-18-17/h3-9H,1-2H3,(H,18,21)(H,19,20,22) |
| InChIKey | IOOUWOPZKXPITN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-isoquinolin-1-yl-4,6-dimethyl-2H-benzotriazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-isoquinolin-1-yl-4,6-dimethyl-2H-benzotriazole-5-sulfonamide?
The IUPAC name of N-isoquinolin-1-yl-4,6-dimethyl-2H-benzotriazole-5-sulfonamide (CID 58237693) is N-isoquinolin-1-yl-4,6-dimethyl-2H-benzotriazole-5-sulfonamide.
What is the SMILES notation for N-isoquinolin-1-yl-4,6-dimethyl-2H-benzotriazole-5-sulfonamide?
The canonical SMILES for N-isoquinolin-1-yl-4,6-dimethyl-2H-benzotriazole-5-sulfonamide is Cc1cc2n[nH]nc2c(C)c1S(=O)(=O)Nc1nccc2ccccc12.
What is the InChIKey of N-isoquinolin-1-yl-4,6-dimethyl-2H-benzotriazole-5-sulfonamide?
The InChIKey is IOOUWOPZKXPITN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N5O2S/c1-10-9-14-15(20-22-19-14)11(2)16(10)25(23,24)21-17-13-6-4-3-5-12(13)7-8-18-17/h3-9H,1-2H3,(H,18,21)(H,19,20,22).
What are the key properties of N-isoquinolin-1-yl-4,6-dimethyl-2H-benzotriazole-5-sulfonamide?
N-isoquinolin-1-yl-4,6-dimethyl-2H-benzotriazole-5-sulfonamide has a molecular weight of 353.41 g/mol, XLogP of 2.92, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-isoquinolin-1-yl-4,6-dimethyl-2H-benzotriazole-5-sulfonamide is sourced from PubChem (CID 58237693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).