C29H40BNO4 — CID 58237932
(4R)-4-(2-hydroxy-2-methylpropyl)-4-phenyl-1-[(1S)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]piperidin-2-one (PubChem CID 58237932) has the molecular formula C29H40BNO4 and a molecular weight of 477.45 g/mol. Its IUPAC name is (4R)-4-(2-hydroxy-2-methylpropyl)-4-phenyl-1-[(1S)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]piperidin-2-one.
| Compound Name | (4R)-4-(2-hydroxy-2-methylpropyl)-4-phenyl-1-[(1S)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]piperidin-2-one |
|---|---|
| PubChem CID | 58237932 |
| Molecular Formula | C29H40BNO4 |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | (4R)-4-(2-hydroxy-2-methylpropyl)-4-phenyl-1-[(1S)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]piperidin-2-one |
| SMILES | C[C@@H](c1ccc(B2OC(C)(C)C(C)(C)O2)cc1)N1CC[C@](CC(C)(C)O)(c2ccccc2)CC1=O |
| InChI | InChI=1S/C29H40BNO4/c1-21(22-13-15-24(16-14-22)30-34-27(4,5)28(6,7)35-30)31-18-17-29(19-25(31)32,20-26(2,3)33)23-11-9-8-10-12-23/h8-16,21,33H,17-20H2,1-7H3/t21-,29-/m0/s1 |
| InChIKey | VWJJWNYCDRZQKW-LGGPFLRQSA-N |
| XLogP | 4.77 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|