About 4-bromocyclohexa-2,4-dien-1-one
4-bromocyclohexa-2,4-dien-1-one (PubChem CID 58237946) has the molecular formula C6H5BrO
and a molecular weight of 173.01 g/mol. Its IUPAC name is 4-bromocyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 4-bromocyclohexa-2,4-dien-1-one |
| PubChem CID | 58237946 |
| Molecular Formula | C6H5BrO |
| Molecular Weight | 173.01 g/mol |
| Exact Mass | 171.95 |
| IUPAC Name | 4-bromocyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC(Br)=CC1 |
| InChI | InChI=1S/C6H5BrO/c7-5-1-3-6(8)4-2-5/h1-3H,4H2 |
| InChIKey | DVGXYTZRRGQRNM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.01 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromocyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromocyclohexa-2,4-dien-1-one?
The IUPAC name of 4-bromocyclohexa-2,4-dien-1-one (CID 58237946) is 4-bromocyclohexa-2,4-dien-1-one.
What is the SMILES notation for 4-bromocyclohexa-2,4-dien-1-one?
The canonical SMILES for 4-bromocyclohexa-2,4-dien-1-one is O=C1C=CC(Br)=CC1.
What is the InChIKey of 4-bromocyclohexa-2,4-dien-1-one?
The InChIKey is DVGXYTZRRGQRNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrO/c7-5-1-3-6(8)4-2-5/h1-3H,4H2.
What are the key properties of 4-bromocyclohexa-2,4-dien-1-one?
4-bromocyclohexa-2,4-dien-1-one has a molecular weight of 173.01 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromocyclohexa-2,4-dien-1-one is sourced from PubChem (CID 58237946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).