C26H14F8O6S — CID 58238453
4-[5-methoxy-2-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)phenoxy]phenyl]benzenesulfonic acid (PubChem CID 58238453) has the molecular formula C26H14F8O6S and a molecular weight of 606.44 g/mol. Its IUPAC name is 4-[5-methoxy-2-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)phenoxy]phenyl]benzenesulfonic acid.
| Compound Name | 4-[5-methoxy-2-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)phenoxy]phenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 58238453 |
| Molecular Formula | C26H14F8O6S |
| Molecular Weight | 606.44 g/mol |
| Exact Mass | 606.04 |
| IUPAC Name | 4-[5-methoxy-2-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)phenoxy]phenyl]benzenesulfonic acid |
| SMILES | COc1ccc(Oc2c(F)c(F)c(-c3c(F)c(F)c(OC)c(F)c3F)c(F)c2F)c(-c2ccc(S(=O)(=O)O)cc2)c1 |
| InChI | InChI=1S/C26H14F8O6S/c1-38-11-5-8-14(13(9-11)10-3-6-12(7-4-10)41(35,36)37)40-26-23(33)19(29)16(20(30)24(26)34)15-17(27)21(31)25(39-2)22(32)18(15)28/h3-9H,1-2H3,(H,35,36,37) |
| InChIKey | KVSLUQKLAYKLDQ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.44 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|