About N-butyl-N',2-dicyclohexyl-N-methylethanimidamide
N-butyl-N',2-dicyclohexyl-N-methylethanimidamide (PubChem CID 58238471) has the molecular formula C19H36N2
and a molecular weight of 292.51 g/mol. Its IUPAC name is N-butyl-N',2-dicyclohexyl-N-methylethanimidamide.
Molecular Properties
| Compound Name | N-butyl-N',2-dicyclohexyl-N-methylethanimidamide |
| PubChem CID | 58238471 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | N-butyl-N',2-dicyclohexyl-N-methylethanimidamide |
| SMILES | CCCCN(C)/C(CC1CCCCC1)=N/C1CCCCC1 |
| InChI | InChI=1S/C19H36N2/c1-3-4-15-21(2)19(16-17-11-7-5-8-12-17)20-18-13-9-6-10-14-18/h17-18H,3-16H2,1-2H3/b20-19+ |
| InChIKey | ACFKUFKACWRFKD-FMQUCBEESA-N |
| XLogP | 5.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N',2-dicyclohexyl-N-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N',2-dicyclohexyl-N-methylethanimidamide?
The IUPAC name of N-butyl-N',2-dicyclohexyl-N-methylethanimidamide (CID 58238471) is N-butyl-N',2-dicyclohexyl-N-methylethanimidamide.
What is the SMILES notation for N-butyl-N',2-dicyclohexyl-N-methylethanimidamide?
The canonical SMILES for N-butyl-N',2-dicyclohexyl-N-methylethanimidamide is CCCCN(C)/C(CC1CCCCC1)=N/C1CCCCC1.
What is the InChIKey of N-butyl-N',2-dicyclohexyl-N-methylethanimidamide?
The InChIKey is ACFKUFKACWRFKD-FMQUCBEESA-N. The full InChI is InChI=1S/C19H36N2/c1-3-4-15-21(2)19(16-17-11-7-5-8-12-17)20-18-13-9-6-10-14-18/h17-18H,3-16H2,1-2H3/b20-19+.
What are the key properties of N-butyl-N',2-dicyclohexyl-N-methylethanimidamide?
N-butyl-N',2-dicyclohexyl-N-methylethanimidamide has a molecular weight of 292.51 g/mol, XLogP of 5.42, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N',2-dicyclohexyl-N-methylethanimidamide is sourced from PubChem (CID 58238471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).