C37H38O2S2 — CID 58239052
2-[[3-[(2S,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thian-2-yl]phenyl]methyl]-1-benzothiophene (PubChem CID 58239052) has the molecular formula C37H38O2S2 and a molecular weight of 578.84 g/mol. Its IUPAC name is 2-[[3-[(2S,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thian-2-yl]phenyl]methyl]-1-benzothiophene.
| Compound Name | 2-[[3-[(2S,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thian-2-yl]phenyl]methyl]-1-benzothiophene |
|---|---|
| PubChem CID | 58239052 |
| Molecular Formula | C37H38O2S2 |
| Molecular Weight | 578.84 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 2-[[3-[(2S,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thian-2-yl]phenyl]methyl]-1-benzothiophene |
| SMILES | CC[C@H]1S[C@@H](c2cccc(Cc3cc4ccccc4s3)c2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C37H38O2S2/c1-3-33-26(2)35(38-24-27-13-6-4-7-14-27)36(39-25-28-15-8-5-9-16-28)37(41-33)31-19-12-17-29(21-31)22-32-23-30-18-10-11-20-34(30)40-32/h4-21,23,26,33,35-37H,3,22,24-25H2,1-2H3/t26-,33-,35+,36-,37+/m1/s1 |
| InChIKey | MWXAROXPCFGRNV-NDYOSRFFSA-N |
| XLogP | 9.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.84 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |