C46H82N4O8 — CID 58239645
tetrakis(1,2,2,6,6-pentamethylpiperidin-4-yl) ethane-1,1,2,2-tetracarboxylate (PubChem CID 58239645) has the molecular formula C46H82N4O8 and a molecular weight of 819.18 g/mol. Its IUPAC name is tetrakis(1,2,2,6,6-pentamethylpiperidin-4-yl) ethane-1,1,2,2-tetracarboxylate.
| Compound Name | tetrakis(1,2,2,6,6-pentamethylpiperidin-4-yl) ethane-1,1,2,2-tetracarboxylate |
|---|---|
| PubChem CID | 58239645 |
| Molecular Formula | C46H82N4O8 |
| Molecular Weight | 819.18 g/mol |
| Exact Mass | 818.61 |
| IUPAC Name | tetrakis(1,2,2,6,6-pentamethylpiperidin-4-yl) ethane-1,1,2,2-tetracarboxylate |
| SMILES | CN1C(C)(C)CC(OC(=O)C(C(=O)OC2CC(C)(C)N(C)C(C)(C)C2)C(C(=O)OC2CC(C)(C)N(C)C(C)(C)C2)C(=O)OC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C46H82N4O8/c1-39(2)21-29(22-40(3,4)47(39)17)55-35(51)33(36(52)56-30-23-41(5,6)48(18)42(7,8)24-30)34(37(53)57-31-25-43(9,10)49(19)44(11,12)26-31)38(54)58-32-27-45(13,14)50(20)46(15,16)28-32/h29-34H,21-28H2,1-20H3 |
| InChIKey | CPXHAMQFMFHBGU-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 118.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.18 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|