C24H9N9O6 — CID 58239857
4,9,14-tri(pyrimidin-4-yl)-4,9,14-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,6,11-triene-3,5,8,10,13,15-hexone (PubChem CID 58239857) has the molecular formula C24H9N9O6 and a molecular weight of 519.39 g/mol. Its IUPAC name is 4,9,14-tri(pyrimidin-4-yl)-4,9,14-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,6,11-triene-3,5,8,10,13,15-hexone.
| Compound Name | 4,9,14-tri(pyrimidin-4-yl)-4,9,14-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,6,11-triene-3,5,8,10,13,15-hexone |
|---|---|
| PubChem CID | 58239857 |
| Molecular Formula | C24H9N9O6 |
| Molecular Weight | 519.39 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | 4,9,14-tri(pyrimidin-4-yl)-4,9,14-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,6,11-triene-3,5,8,10,13,15-hexone |
| SMILES | O=c1c2c3c(=O)n(-c4ccncn4)c(=O)c3c3c(=O)n(-c4ccncn4)c(=O)c3c2c(=O)n1-c1ccncn1 |
| InChI | InChI=1S/C24H9N9O6/c34-19-13-14(20(35)31(19)10-1-4-25-7-28-10)16-18(24(39)33(22(16)37)12-3-6-27-9-30-12)17-15(13)21(36)32(23(17)38)11-2-5-26-8-29-11/h1-9H |
| InChIKey | SHAZBCHNCUMSHO-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 194.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.39 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |