C51H24N18O6 — CID 58239859
4,9,14-tris(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)-4,9,14-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,6,11-triene-3,5,8,10,13,15-hexone (PubChem CID 58239859) has the molecular formula C51H24N18O6 and a molecular weight of 984.87 g/mol. Its IUPAC name is 4,9,14-tris(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)-4,9,14-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,6,11-triene-3,5,8,10,13,15-hexone.
| Compound Name | 4,9,14-tris(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)-4,9,14-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,6,11-triene-3,5,8,10,13,15-hexone |
|---|---|
| PubChem CID | 58239859 |
| Molecular Formula | C51H24N18O6 |
| Molecular Weight | 984.87 g/mol |
| Exact Mass | 984.21 |
| IUPAC Name | 4,9,14-tris(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)-4,9,14-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,6,11-triene-3,5,8,10,13,15-hexone |
| SMILES | O=c1c2c3c(=O)n(-c4nc(-c5ccncc5)nc(-c5ccncc5)n4)c(=O)c3c3c(=O)n(-c4nc(-c5ccncc5)nc(-c5ccncc5)n4)c(=O)c3c2c(=O)n1-c1nc(-c2ccncc2)nc(-c2ccncc2)n1 |
| InChI | InChI=1S/C51H24N18O6/c70-43-31-32(44(71)67(43)49-61-37(25-1-13-52-14-2-25)58-38(62-49)26-3-15-53-16-4-26)34-36(48(75)69(46(34)73)51-65-41(29-9-21-56-22-10-29)60-42(66-51)30-11-23-57-24-12-30)35-33(31)45(72)68(47(35)74)50-63-39(27-5-17-54-18-6-27)59-40(64-50)28-7-19-55-20-8-28/h1-24H |
| InChIKey | WCWQOROCEPWINQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 310.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.87 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |