C53H30N12O — CID 58240012
bis[3,5-bis(4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl)phenyl]methanone (PubChem CID 58240012) has the molecular formula C53H30N12O and a molecular weight of 850.91 g/mol. Its IUPAC name is bis[3,5-bis(4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl)phenyl]methanone.
| Compound Name | bis[3,5-bis(4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl)phenyl]methanone |
|---|---|
| PubChem CID | 58240012 |
| Molecular Formula | C53H30N12O |
| Molecular Weight | 850.91 g/mol |
| Exact Mass | 850.27 |
| IUPAC Name | bis[3,5-bis(4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl)phenyl]methanone |
| SMILES | O=C(c1cc(-n2c3ccncc3c3cnccc32)cc(-n2c3ccncc3c3cnccc32)c1)c1cc(-n2c3ccncc3c3cnccc32)cc(-n2c3ccncc3c3cnccc32)c1 |
| InChI | InChI=1S/C53H30N12O/c66-53(31-17-33(62-45-1-9-54-23-37(45)38-24-55-10-2-46(38)62)21-34(18-31)63-47-3-11-56-25-39(47)40-26-57-12-4-48(40)63)32-19-35(64-49-5-13-58-27-41(49)42-28-59-14-6-50(42)64)22-36(20-32)65-51-7-15-60-29-43(51)44-30-61-16-8-52(44)65/h1-30H |
| InChIKey | QXFCALOMRWCTTK-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 139.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.91 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |