C33H22N4O — CID 58240129
bis(3,5-dipyridin-4-ylphenyl)methanone (PubChem CID 58240129) has the molecular formula C33H22N4O and a molecular weight of 490.57 g/mol. Its IUPAC name is bis(3,5-dipyridin-4-ylphenyl)methanone.
| Compound Name | bis(3,5-dipyridin-4-ylphenyl)methanone |
|---|---|
| PubChem CID | 58240129 |
| Molecular Formula | C33H22N4O |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | bis(3,5-dipyridin-4-ylphenyl)methanone |
| SMILES | O=C(c1cc(-c2ccncc2)cc(-c2ccncc2)c1)c1cc(-c2ccncc2)cc(-c2ccncc2)c1 |
| InChI | InChI=1S/C33H22N4O/c38-33(31-19-27(23-1-9-34-10-2-23)17-28(20-31)24-3-11-35-12-4-24)32-21-29(25-5-13-36-14-6-25)18-30(22-32)26-7-15-37-16-8-26/h1-22H |
| InChIKey | LZGCPZWXQRCESV-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |