C10H13F9N2O6S3 — CID 58240456
1,1,2,2,3,3-hexafluoro-N-methyl-3-piperidin-1-ylsulfonyl-N-(trifluoromethylsulfonyl)propane-1-sulfonamide (PubChem CID 58240456) has the molecular formula C10H13F9N2O6S3 and a molecular weight of 524.41 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-N-methyl-3-piperidin-1-ylsulfonyl-N-(trifluoromethylsulfonyl)propane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3-hexafluoro-N-methyl-3-piperidin-1-ylsulfonyl-N-(trifluoromethylsulfonyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 58240456 |
| Molecular Formula | C10H13F9N2O6S3 |
| Molecular Weight | 524.41 g/mol |
| Exact Mass | 523.98 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-N-methyl-3-piperidin-1-ylsulfonyl-N-(trifluoromethylsulfonyl)propane-1-sulfonamide |
| SMILES | CN(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C10H13F9N2O6S3/c1-20(30(26,27)10(17,18)19)28(22,23)8(13,14)7(11,12)9(15,16)29(24,25)21-5-3-2-4-6-21/h2-6H2,1H3 |
| InChIKey | OZWLHHZQBJGWHI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|