C15H29NO3 — CID 58241255
(6R)-4,5,6-trimethoxy-N,N-dipropylcyclohex-2-en-1-amine (PubChem CID 58241255) has the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. Its IUPAC name is (6R)-4,5,6-trimethoxy-N,N-dipropylcyclohex-2-en-1-amine.
| Compound Name | (6R)-4,5,6-trimethoxy-N,N-dipropylcyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 58241255 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | (6R)-4,5,6-trimethoxy-N,N-dipropylcyclohex-2-en-1-amine |
| SMILES | CCCN(CCC)C1C=CC(OC)C(OC)[C@@H]1OC |
| InChI | InChI=1S/C15H29NO3/c1-6-10-16(11-7-2)12-8-9-13(17-3)15(19-5)14(12)18-4/h8-9,12-15H,6-7,10-11H2,1-5H3/t12?,13?,14-,15?/m1/s1 |
| InChIKey | ZGAMRLBOMCVAIY-MIGSVPMKSA-N |
| XLogP | 2.09 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|