C13H22O4 — CID 58241279
3-(6-hydroxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl)butan-2-one (PubChem CID 58241279) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is 3-(6-hydroxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl)butan-2-one.
| Compound Name | 3-(6-hydroxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl)butan-2-one |
|---|---|
| PubChem CID | 58241279 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 3-(6-hydroxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl)butan-2-one |
| SMILES | CC(=O)C(C)C1CC(O)CC2OC(C)(C)OC21 |
| InChI | InChI=1S/C13H22O4/c1-7(8(2)14)10-5-9(15)6-11-12(10)17-13(3,4)16-11/h7,9-12,15H,5-6H2,1-4H3 |
| InChIKey | FWGOOYIWHZMXHZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |