C9H16F2O — CID 58241357
(4S,5R)-2-fluoro-6-(fluoromethyl)-3,4,5-trimethyloxane (PubChem CID 58241357) has the molecular formula C9H16F2O and a molecular weight of 178.22 g/mol. Its IUPAC name is (4S,5R)-2-fluoro-6-(fluoromethyl)-3,4,5-trimethyloxane.
| Compound Name | (4S,5R)-2-fluoro-6-(fluoromethyl)-3,4,5-trimethyloxane |
|---|---|
| PubChem CID | 58241357 |
| Molecular Formula | C9H16F2O |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | (4S,5R)-2-fluoro-6-(fluoromethyl)-3,4,5-trimethyloxane |
| SMILES | CC1C(F)OC(CF)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C9H16F2O/c1-5-6(2)8(4-10)12-9(11)7(5)3/h5-9H,4H2,1-3H3/t5-,6+,7?,8?,9?/m0/s1 |
| InChIKey | MVHFUOUNPXEPPL-YPKBUBAISA-N |
| XLogP | 2.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |